C14H20N2 — CID 82127096
2-(3,4-dimethylanilino)-4-methylpentanenitrile (PubChem CID 82127096) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-4-methylpentanenitrile.
| Compound Name | 2-(3,4-dimethylanilino)-4-methylpentanenitrile |
|---|---|
| PubChem CID | 82127096 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(3,4-dimethylanilino)-4-methylpentanenitrile |
| SMILES | Cc1ccc(NC(C#N)CC(C)C)cc1C |
| InChI | InChI=1S/C14H20N2/c1-10(2)7-14(9-15)16-13-6-5-11(3)12(4)8-13/h5-6,8,10,14,16H,7H2,1-4H3 |
| InChIKey | AIVPWDKXZYPDFJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |