C19H19ClN2O4 — CID 86281135
[4-chloro-2-[cyano-(3,5-dimethoxyanilino)methyl]phenyl] propanoate (PubChem CID 86281135) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is [4-chloro-2-[cyano-(3,5-dimethoxyanilino)methyl]phenyl] propanoate.
| Compound Name | [4-chloro-2-[cyano-(3,5-dimethoxyanilino)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 86281135 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [4-chloro-2-[cyano-(3,5-dimethoxyanilino)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(Cl)cc1C(C#N)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C19H19ClN2O4/c1-4-19(23)26-18-6-5-12(20)7-16(18)17(11-21)22-13-8-14(24-2)10-15(9-13)25-3/h5-10,17,22H,4H2,1-3H3 |
| InChIKey | FMQXNWVTKNPXAT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|