C26H29NO7 — CID 144703912
[(2E,4E)-5-[4-(3-acetyloxypropoxy)benzoyl]oxyhexa-2,4-dien-2-yl] 4-(methylamino)benzoate (PubChem CID 144703912) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is [(2E,4E)-5-[4-(3-acetyloxypropoxy)benzoyl]oxyhexa-2,4-dien-2-yl] 4-(methylamino)benzoate.
| Compound Name | [(2E,4E)-5-[4-(3-acetyloxypropoxy)benzoyl]oxyhexa-2,4-dien-2-yl] 4-(methylamino)benzoate |
|---|---|
| PubChem CID | 144703912 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [(2E,4E)-5-[4-(3-acetyloxypropoxy)benzoyl]oxyhexa-2,4-dien-2-yl] 4-(methylamino)benzoate |
| SMILES | CNc1ccc(C(=O)O/C(C)=C/C=C(\C)OC(=O)c2ccc(OCCCOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H29NO7/c1-18(33-25(29)21-8-12-23(27-4)13-9-21)6-7-19(2)34-26(30)22-10-14-24(15-11-22)32-17-5-16-31-20(3)28/h6-15,27H,5,16-17H2,1-4H3/b18-6+,19-7+ |
| InChIKey | JMGYKMDNQWMTOL-JRGWAENISA-N |
| XLogP | 4.88 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|