C30H31NO8 — CID 144596411
[(2E,4E)-5-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-2-yl] 4-acetamidobenzoate (PubChem CID 144596411) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is [(2E,4E)-5-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-2-yl] 4-acetamidobenzoate.
| Compound Name | [(2E,4E)-5-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-2-yl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 144596411 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | [(2E,4E)-5-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-2-yl] 4-acetamidobenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)O/C(C=C)=C/C=C(\C)OC(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C30H31NO8/c1-5-26(16-9-21(3)38-29(34)23-10-14-25(15-11-23)31-22(4)32)39-30(35)24-12-17-27(18-13-24)36-19-7-8-20-37-28(33)6-2/h5-6,9-18H,1-2,7-8,19-20H2,3-4H3,(H,31,32)/b21-9+,26-16+ |
| InChIKey | UTGVVUJOESKSBH-UCFCGNAVSA-N |
| XLogP | 5.52 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|