C29H34O6 — CID 126517557
[4-[(2E,4E)-5-methoxyhexa-2,4-dien-2-yl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 126517557) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is [4-[(2E,4E)-5-methoxyhexa-2,4-dien-2-yl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[(2E,4E)-5-methoxyhexa-2,4-dien-2-yl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 126517557 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [4-[(2E,4E)-5-methoxyhexa-2,4-dien-2-yl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/C(C)=C/C=C(\C)OC)cc2)cc1 |
| InChI | InChI=1S/C29H34O6/c1-5-28(30)34-21-9-7-6-8-20-33-26-16-14-25(15-17-26)29(31)35-27-18-12-24(13-19-27)22(2)10-11-23(3)32-4/h5,10-19H,1,6-9,20-21H2,2-4H3/b22-10+,23-11+ |
| InChIKey | HPWOHWPSGPKRRC-CZGKVYIXSA-N |
| XLogP | 6.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|