C45H48N2O10 — CID 58451738
[4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-(4-acetyloxybutoxy)benzoate (PubChem CID 58451738) has the molecular formula C45H48N2O10 and a molecular weight of 776.88 g/mol. Its IUPAC name is [4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-(4-acetyloxybutoxy)benzoate.
| Compound Name | [4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-(4-acetyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 58451738 |
| Molecular Formula | C45H48N2O10 |
| Molecular Weight | 776.88 g/mol |
| Exact Mass | 776.33 |
| IUPAC Name | [4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-(4-acetyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(/C(CC)=N/N=C(\CC)c3ccc(OC(=O)c4ccc(OCCCCOC(C)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H48N2O10/c1-5-41(33-12-24-39(25-13-33)56-44(50)35-16-20-37(21-17-35)53-29-9-8-28-52-32(4)48)46-47-42(6-2)34-14-26-40(27-15-34)57-45(51)36-18-22-38(23-19-36)54-30-10-11-31-55-43(49)7-3/h7,12-27H,3,5-6,8-11,28-31H2,1-2,4H3/b46-41+,47-42+ |
| InChIKey | PJBUTWUEOJBORF-DKVNQICBSA-N |
| XLogP | 8.75 |
| TPSA | 148.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.88 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|