C41H44N2O7 — CID 144596314
[4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-propanoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-ethylbenzoate (PubChem CID 144596314) has the molecular formula C41H44N2O7 and a molecular weight of 676.81 g/mol. Its IUPAC name is [4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-propanoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-ethylbenzoate.
| Compound Name | [4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-propanoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 144596314 |
| Molecular Formula | C41H44N2O7 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | [4-[(E)-C-ethyl-N-[(E)-1-[4-[4-(4-propanoyloxybutoxy)benzoyl]oxyphenyl]propylideneamino]carbonimidoyl]phenyl] 4-ethylbenzoate |
| SMILES | CCC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(/C(CC)=N/N=C(\CC)c3ccc(OC(=O)c4ccc(CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H44N2O7/c1-5-29-11-13-32(14-12-29)40(45)49-35-23-15-30(16-24-35)37(6-2)42-43-38(7-3)31-17-25-36(26-18-31)50-41(46)33-19-21-34(22-20-33)47-27-9-10-28-48-39(44)8-4/h11-26H,5-10,27-28H2,1-4H3/b42-37+,43-38+ |
| InChIKey | IKDRWXCKJYREED-QMGZYAOISA-N |
| XLogP | 8.81 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|