N-methyl-propylphosphonamidous acid

C4H12NOP — CID 144706923

IUPACN-methyl-propylphosphonamidous acid
SMILESCCCP(O)NC
InChIInChI=1S/C4H12NOP/c1-3-4-7(6)5-2/h5-6H,3-4H2,1-2H3
InChIKeyCHNMNBPQAHOTFR-UHFFFAOYSA-N
MW121.12 g/mol
LogP0.92
Rot. Bonds3

About N-methyl-propylphosphonamidous acid

N-methyl-propylphosphonamidous acid (PubChem CID 144706923) has the molecular formula C4H12NOP and a molecular weight of 121.12 g/mol. Its IUPAC name is N-methyl-propylphosphonamidous acid.

Molecular Properties

Compound NameN-methyl-propylphosphonamidous acid
PubChem CID144706923
Molecular FormulaC4H12NOP
Molecular Weight121.12 g/mol
Exact Mass121.07
IUPAC NameN-methyl-propylphosphonamidous acid
SMILESCCCP(O)NC
InChIInChI=1S/C4H12NOP/c1-3-4-7(6)5-2/h5-6H,3-4H2,1-2H3
InChIKeyCHNMNBPQAHOTFR-UHFFFAOYSA-N
XLogP0.92
TPSA32.26 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500121.12
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N-methyl-propylphosphonamidous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-propylphosphonamidous acid?
The IUPAC name of N-methyl-propylphosphonamidous acid (CID 144706923) is N-methyl-propylphosphonamidous acid.
What is the SMILES notation for N-methyl-propylphosphonamidous acid?
The canonical SMILES for N-methyl-propylphosphonamidous acid is CCCP(O)NC.
What is the InChIKey of N-methyl-propylphosphonamidous acid?
The InChIKey is CHNMNBPQAHOTFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12NOP/c1-3-4-7(6)5-2/h5-6H,3-4H2,1-2H3.
What are the key properties of N-methyl-propylphosphonamidous acid?
N-methyl-propylphosphonamidous acid has a molecular weight of 121.12 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-propylphosphonamidous acid is sourced from PubChem (CID 144706923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).