C15H21FN3O6P — CID 144706987
2-[(4-fluorobenzoyl)amino]-5-[2-[hydroxy(methylamino)phosphanyl]oxyethylamino]-5-oxopentanoic acid (PubChem CID 144706987) has the molecular formula C15H21FN3O6P and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-5-[2-[hydroxy(methylamino)phosphanyl]oxyethylamino]-5-oxopentanoic acid.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-5-[2-[hydroxy(methylamino)phosphanyl]oxyethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 144706987 |
| Molecular Formula | C15H21FN3O6P |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-5-[2-[hydroxy(methylamino)phosphanyl]oxyethylamino]-5-oxopentanoic acid |
| SMILES | CNP(O)OCCNC(=O)CCC(NC(=O)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C15H21FN3O6P/c1-17-26(24)25-9-8-18-13(20)7-6-12(15(22)23)19-14(21)10-2-4-11(16)5-3-10/h2-5,12,17,24H,6-9H2,1H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | UAOZKMQKTNWBIB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|