C10H22N3O5P — CID 144707010
5-[4-[amino(hydroxy)phosphanyl]oxybutylamino]-2-(methylamino)-5-oxopentanoic acid (PubChem CID 144707010) has the molecular formula C10H22N3O5P and a molecular weight of 295.28 g/mol. Its IUPAC name is 5-[4-[amino(hydroxy)phosphanyl]oxybutylamino]-2-(methylamino)-5-oxopentanoic acid.
| Compound Name | 5-[4-[amino(hydroxy)phosphanyl]oxybutylamino]-2-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 144707010 |
| Molecular Formula | C10H22N3O5P |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-[4-[amino(hydroxy)phosphanyl]oxybutylamino]-2-(methylamino)-5-oxopentanoic acid |
| SMILES | CNC(CCC(=O)NCCCCOP(N)O)C(=O)O |
| InChI | InChI=1S/C10H22N3O5P/c1-12-8(10(15)16)4-5-9(14)13-6-2-3-7-18-19(11)17/h8,12,17H,2-7,11H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | JGSZPCXLOUNTAF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|