C22H40N3O7P — CID 166960953
5-[[(1S)-1-carboxy-4-[[(5S)-6-dimethylphosphanyl-5-(methylamino)-6-oxohexyl]amino]-4-oxobutyl]amino]-2,4,4-trimethyl-5-oxopentanoic acid (PubChem CID 166960953) has the molecular formula C22H40N3O7P and a molecular weight of 489.55 g/mol. Its IUPAC name is 5-[[(1S)-1-carboxy-4-[[(5S)-6-dimethylphosphanyl-5-(methylamino)-6-oxohexyl]amino]-4-oxobutyl]amino]-2,4,4-trimethyl-5-oxopentanoic acid.
| Compound Name | 5-[[(1S)-1-carboxy-4-[[(5S)-6-dimethylphosphanyl-5-(methylamino)-6-oxohexyl]amino]-4-oxobutyl]amino]-2,4,4-trimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166960953 |
| Molecular Formula | C22H40N3O7P |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 5-[[(1S)-1-carboxy-4-[[(5S)-6-dimethylphosphanyl-5-(methylamino)-6-oxohexyl]amino]-4-oxobutyl]amino]-2,4,4-trimethyl-5-oxopentanoic acid |
| SMILES | CN[C@@H](CCCCNC(=O)CC[C@H](NC(=O)C(C)(C)CC(C)C(=O)O)C(=O)O)C(=O)P(C)C |
| InChI | InChI=1S/C22H40N3O7P/c1-14(18(27)28)13-22(2,3)21(32)25-15(19(29)30)10-11-17(26)24-12-8-7-9-16(23-4)20(31)33(5)6/h14-16,23H,7-13H2,1-6H3,(H,24,26)(H,25,32)(H,27,28)(H,29,30)/t14?,15-,16-/m0/s1 |
| InChIKey | BVJLJIJWSIHMPB-YVZMLIKISA-N |
| XLogP | 1.62 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|