C24H25F3N4O5+2 — CID 144707140
3-[7-benzyl-3-ethyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-1-yl]propyloxidanium (PubChem CID 144707140) has the molecular formula C24H25F3N4O5+2 and a molecular weight of 506.48 g/mol. Its IUPAC name is 3-[7-benzyl-3-ethyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-1-yl]propyloxidanium.
| Compound Name | 3-[7-benzyl-3-ethyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-1-yl]propyloxidanium |
|---|---|
| PubChem CID | 144707140 |
| Molecular Formula | C24H25F3N4O5+2 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 3-[7-benzyl-3-ethyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-1-yl]propyloxidanium |
| SMILES | CCn1c(=O)n(CCC[OH2+])c(=O)c2c1[nH]c(Oc1cccc(OC(F)(F)F)c1)[n+]2Cc1ccccc1 |
| InChI | InChI=1S/C24H23F3N4O5/c1-2-29-20-19(21(33)30(23(29)34)12-7-13-32)31(15-16-8-4-3-5-9-16)22(28-20)35-17-10-6-11-18(14-17)36-24(25,26)27/h3-6,8-11,14,32H,2,7,12-13,15H2,1H3/p+2 |
| InChIKey | FFNPLKZYLCJAOJ-UHFFFAOYSA-P |
| XLogP | 2.65 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|