C11H20N5O2+ — CID 144708838
[4-amino-6-[butan-2-yl(ethyl)amino]pyrimidin-5-yl]-methoxy-oxoazanium (PubChem CID 144708838) has the molecular formula C11H20N5O2+ and a molecular weight of 254.31 g/mol. Its IUPAC name is [4-amino-6-[butan-2-yl(ethyl)amino]pyrimidin-5-yl]-methoxy-oxoazanium.
| Compound Name | [4-amino-6-[butan-2-yl(ethyl)amino]pyrimidin-5-yl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 144708838 |
| Molecular Formula | C11H20N5O2+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [4-amino-6-[butan-2-yl(ethyl)amino]pyrimidin-5-yl]-methoxy-oxoazanium |
| SMILES | CCC(C)N(CC)c1ncnc(N)c1[N+](=O)OC |
| InChI | InChI=1S/C11H20N5O2/c1-5-8(3)15(6-2)11-9(16(17)18-4)10(12)13-7-14-11/h7-8H,5-6H2,1-4H3,(H2,12,13,14)/q+1 |
| InChIKey | ZNKBFCVKMOJXLH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 84.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|