C19H17FN2 — CID 144713889
ethane;2-fluoro-9,9-dimethylfluorene-1,3-dicarbonitrile (PubChem CID 144713889) has the molecular formula C19H17FN2 and a molecular weight of 292.36 g/mol. Its IUPAC name is ethane;2-fluoro-9,9-dimethylfluorene-1,3-dicarbonitrile.
| Compound Name | ethane;2-fluoro-9,9-dimethylfluorene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 144713889 |
| Molecular Formula | C19H17FN2 |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethane;2-fluoro-9,9-dimethylfluorene-1,3-dicarbonitrile |
| SMILES | CC.CC1(C)c2ccccc2-c2cc(C#N)c(F)c(C#N)c21 |
| InChI | InChI=1S/C17H11FN2.C2H6/c1-17(2)14-6-4-3-5-11(14)12-7-10(8-19)16(18)13(9-20)15(12)17;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | HEVYBNNJUVXNDS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |