C26H30N4 — CID 144714092
14,15-diethyl-8,8,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 144714092) has the molecular formula C26H30N4 and a molecular weight of 398.55 g/mol. Its IUPAC name is 14,15-diethyl-8,8,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 14,15-diethyl-8,8,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 144714092 |
| Molecular Formula | C26H30N4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 14,15-diethyl-8,8,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CCc1nc2c(nc1CC)N1c3ccccc3C(C)(C)C(C)C1N2c1ccccc1 |
| InChI | InChI=1S/C26H30N4/c1-6-20-21(7-2)28-24-23(27-20)29(18-13-9-8-10-14-18)25-17(3)26(4,5)19-15-11-12-16-22(19)30(24)25/h8-17,25H,6-7H2,1-5H3 |
| InChIKey | PMMIHUOVWRBVKO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |