C17H15IO3 — CID 144714555
[4-(4-methoxyphenyl)phenyl] 2-(iodomethyl)prop-2-enoate (PubChem CID 144714555) has the molecular formula C17H15IO3 and a molecular weight of 394.21 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)phenyl] 2-(iodomethyl)prop-2-enoate.
| Compound Name | [4-(4-methoxyphenyl)phenyl] 2-(iodomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 144714555 |
| Molecular Formula | C17H15IO3 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | [4-(4-methoxyphenyl)phenyl] 2-(iodomethyl)prop-2-enoate |
| SMILES | C=C(CI)C(=O)Oc1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H15IO3/c1-12(11-18)17(19)21-16-9-5-14(6-10-16)13-3-7-15(20-2)8-4-13/h3-10H,1,11H2,2H3 |
| InChIKey | YJBSPULREAATED-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|