C7H14N2S — CID 144716042
ethane;5-methylthiophene-2,4-diamine (PubChem CID 144716042) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is ethane;5-methylthiophene-2,4-diamine.
| Compound Name | ethane;5-methylthiophene-2,4-diamine |
|---|---|
| PubChem CID | 144716042 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethane;5-methylthiophene-2,4-diamine |
| SMILES | CC.Cc1sc(N)cc1N |
| InChI | InChI=1S/C5H8N2S.C2H6/c1-3-4(6)2-5(7)8-3;1-2/h2H,6-7H2,1H3;1-2H3 |
| InChIKey | BYBPKZVUVWIVBU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |