C22H46N4O3 — CID 144717088
1-tert-butyl-3-[5-(7,7-dimethyloctylcarbamoylamino)-6-hydroxyhexyl]urea (PubChem CID 144717088) has the molecular formula C22H46N4O3 and a molecular weight of 414.64 g/mol. Its IUPAC name is 1-tert-butyl-3-[5-(7,7-dimethyloctylcarbamoylamino)-6-hydroxyhexyl]urea.
| Compound Name | 1-tert-butyl-3-[5-(7,7-dimethyloctylcarbamoylamino)-6-hydroxyhexyl]urea |
|---|---|
| PubChem CID | 144717088 |
| Molecular Formula | C22H46N4O3 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.36 |
| IUPAC Name | 1-tert-butyl-3-[5-(7,7-dimethyloctylcarbamoylamino)-6-hydroxyhexyl]urea |
| SMILES | CC(C)(C)CCCCCCNC(=O)NC(CO)CCCCNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H46N4O3/c1-21(2,3)14-10-7-8-11-15-23-19(28)25-18(17-27)13-9-12-16-24-20(29)26-22(4,5)6/h18,27H,7-17H2,1-6H3,(H2,23,25,28)(H2,24,26,29) |
| InChIKey | RJYYTGIAVCLYLV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|