C11H19NS — CID 144717979
(1Z,4Z)-3-methyl-1-(propylideneamino)hepta-1,4-diene-3-thiol (PubChem CID 144717979) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (1Z,4Z)-3-methyl-1-(propylideneamino)hepta-1,4-diene-3-thiol.
| Compound Name | (1Z,4Z)-3-methyl-1-(propylideneamino)hepta-1,4-diene-3-thiol |
|---|---|
| PubChem CID | 144717979 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (1Z,4Z)-3-methyl-1-(propylideneamino)hepta-1,4-diene-3-thiol |
| SMILES | CC/C=C\C(C)(S)/C=C\N=C\CC |
| InChI | InChI=1S/C11H19NS/c1-4-6-7-11(3,13)8-10-12-9-5-2/h6-10,13H,4-5H2,1-3H3/b7-6-,10-8-,12-9+ |
| InChIKey | ZPSDDOOXUZLPMO-MLMFGTCKSA-N |
| XLogP | 3.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|