C12H23N — CID 145157841
N-[(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]ethanimine;ethane (PubChem CID 145157841) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-[(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]ethanimine;ethane.
| Compound Name | N-[(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]ethanimine;ethane |
|---|---|
| PubChem CID | 145157841 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-[(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]ethanimine;ethane |
| SMILES | C/C=C\C(C)(C)/C=C\N=C\C.CC |
| InChI | InChI=1S/C10H17N.C2H6/c1-5-7-10(3,4)8-9-11-6-2;1-2/h5-9H,1-4H3;1-2H3/b7-5-,9-8-,11-6+; |
| InChIKey | JLVNGDVTDVARGU-MXPUASAOSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|