C10H15NS — CID 123913493
4,7,7-trimethylazocine-4-thiol (PubChem CID 123913493) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 4,7,7-trimethylazocine-4-thiol.
| Compound Name | 4,7,7-trimethylazocine-4-thiol |
|---|---|
| PubChem CID | 123913493 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4,7,7-trimethylazocine-4-thiol |
| SMILES | CC1(S)C=C/N=C\C(C)(C)C=C1 |
| InChI | InChI=1S/C10H15NS/c1-9(2)4-5-10(3,12)6-7-11-8-9/h4-8,12H,1-3H3/b5-4?,7-6?,11-8- |
| InChIKey | FWHBASFTGPNJJG-FGDKBVDRSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|