C11H17N — CID 126656485
(4Z,7Z)-3,3,6,6-tetramethylazocine (PubChem CID 126656485) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (4Z,7Z)-3,3,6,6-tetramethylazocine.
| Compound Name | (4Z,7Z)-3,3,6,6-tetramethylazocine |
|---|---|
| PubChem CID | 126656485 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (4Z,7Z)-3,3,6,6-tetramethylazocine |
| SMILES | CC1(C)/C=C\N=C/C(C)(C)/C=C\1 |
| InChI | InChI=1S/C11H17N/c1-10(2)5-6-11(3,4)9-12-8-7-10/h5-9H,1-4H3/b6-5-,8-7-,12-9- |
| InChIKey | WRCOUAFWSGXGEL-SEDUXTPZSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|