C9H13N — CID 123944189
7,7-dimethyl-4H-azocine (PubChem CID 123944189) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 7,7-dimethyl-4H-azocine.
| Compound Name | 7,7-dimethyl-4H-azocine |
|---|---|
| PubChem CID | 123944189 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 7,7-dimethyl-4H-azocine |
| SMILES | CC1(C)C=CCC=C/N=C\1 |
| InChI | InChI=1S/C9H13N/c1-9(2)6-4-3-5-7-10-8-9/h4-8H,3H2,1-2H3/b6-4?,7-5?,10-8- |
| InChIKey | NCTINICUJVYLSM-UVKRLPJGSA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|