C30H37F3N8O3 — CID 144721389
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[2-[(6-tert-butyl-1H-benzimidazol-2-yl)methyl]spiro[2.3]hexan-5-yl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol (PubChem CID 144721389) has the molecular formula C30H37F3N8O3 and a molecular weight of 614.67 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[2-[(6-tert-butyl-1H-benzimidazol-2-yl)methyl]spiro[2.3]hexan-5-yl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[2-[(6-tert-butyl-1H-benzimidazol-2-yl)methyl]spiro[2.3]hexan-5-yl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 144721389 |
| Molecular Formula | C30H37F3N8O3 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[2-[(6-tert-butyl-1H-benzimidazol-2-yl)methyl]spiro[2.3]hexan-5-yl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)c1ccc2nc(CC3CC34CC(N(C[C@H]3O[C@@H](n5cnc6c(N)ncnc65)[C@H](O)[C@@H]3O)CC(F)(F)F)C4)[nH]c2c1 |
| InChI | InChI=1S/C30H37F3N8O3/c1-28(2,3)15-4-5-18-19(6-15)39-21(38-18)7-16-8-29(16)9-17(10-29)40(12-30(31,32)33)11-20-23(42)24(43)27(44-20)41-14-37-22-25(34)35-13-36-26(22)41/h4-6,13-14,16-17,20,23-24,27,42-43H,7-12H2,1-3H3,(H,38,39)(H2,34,35,36)/t16?,17?,20-,23-,24-,27-,29?/m1/s1 |
| InChIKey | UZTVOXIHHZDTHB-SBJGUGFISA-N |
| XLogP | 3.48 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |