C20H26F2O — CID 144724169
2-[(4-ethenyl-2,3-difluorophenoxy)methyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 144724169) has the molecular formula C20H26F2O and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-[(4-ethenyl-2,3-difluorophenoxy)methyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[(4-ethenyl-2,3-difluorophenoxy)methyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 144724169 |
| Molecular Formula | C20H26F2O |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[(4-ethenyl-2,3-difluorophenoxy)methyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=Cc1ccc(OCC2CCC3CC(C)CCC3C2)c(F)c1F |
| InChI | InChI=1S/C20H26F2O/c1-3-15-8-9-18(20(22)19(15)21)23-12-14-5-7-16-10-13(2)4-6-17(16)11-14/h3,8-9,13-14,16-17H,1,4-7,10-12H2,2H3 |
| InChIKey | DPZBAIZTWWNLJB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |