C13H21NO3 — CID 144724406
ethyl 2-methyl-4-(3,4,4-trimethyl-1,3-oxazolidin-2-ylidene)but-2-enoate (PubChem CID 144724406) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is ethyl 2-methyl-4-(3,4,4-trimethyl-1,3-oxazolidin-2-ylidene)but-2-enoate.
| Compound Name | ethyl 2-methyl-4-(3,4,4-trimethyl-1,3-oxazolidin-2-ylidene)but-2-enoate |
|---|---|
| PubChem CID | 144724406 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | ethyl 2-methyl-4-(3,4,4-trimethyl-1,3-oxazolidin-2-ylidene)but-2-enoate |
| SMILES | CCOC(=O)C(C)=CC=C1OCC(C)(C)N1C |
| InChI | InChI=1S/C13H21NO3/c1-6-16-12(15)10(2)7-8-11-14(5)13(3,4)9-17-11/h7-8H,6,9H2,1-5H3 |
| InChIKey | OHQMHZJYBGJQIC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|