C17H27FN2O2 — CID 144726906
1-fluoro-2-methylbenzene;N-hydroxycyclopentanecarboxamide;pyrrolidine (PubChem CID 144726906) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is 1-fluoro-2-methylbenzene;N-hydroxycyclopentanecarboxamide;pyrrolidine.
| Compound Name | 1-fluoro-2-methylbenzene;N-hydroxycyclopentanecarboxamide;pyrrolidine |
|---|---|
| PubChem CID | 144726906 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-fluoro-2-methylbenzene;N-hydroxycyclopentanecarboxamide;pyrrolidine |
| SMILES | C1CCNC1.Cc1ccccc1F.O=C(NO)C1CCCC1 |
| InChI | InChI=1S/C7H7F.C6H11NO2.C4H9N/c1-6-4-2-3-5-7(6)8;8-6(7-9)5-3-1-2-4-5;1-2-4-5-3-1/h2-5H,1H3;5,9H,1-4H2,(H,7,8);5H,1-4H2 |
| InChIKey | KNHMEYSPPVOGHI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|