C10H18N2 — CID 144727000
N'-[(E)-2-methylbut-1-enyl]-N-prop-1-en-2-ylethanimidamide (PubChem CID 144727000) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-[(E)-2-methylbut-1-enyl]-N-prop-1-en-2-ylethanimidamide.
| Compound Name | N'-[(E)-2-methylbut-1-enyl]-N-prop-1-en-2-ylethanimidamide |
|---|---|
| PubChem CID | 144727000 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-[(E)-2-methylbut-1-enyl]-N-prop-1-en-2-ylethanimidamide |
| SMILES | C=C(C)N/C(C)=N/C=C(\C)CC |
| InChI | InChI=1S/C10H18N2/c1-6-9(4)7-11-10(5)12-8(2)3/h7H,2,6H2,1,3-5H3,(H,11,12)/b9-7+ |
| InChIKey | VYUYYAFANPFAGD-VQHVLOKHSA-N |
| XLogP | 2.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|