About N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen
N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen (PubChem CID 156715445) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen.
Molecular Properties
| Compound Name | N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen |
| PubChem CID | 156715445 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen |
| SMILES | C=C/N=C(\C)NC(=C)C.[H][H] |
| InChI | InChI=1S/C7H12N2.H2/c1-5-8-7(4)9-6(2)3;/h5H,1-2H2,3-4H3,(H,8,9);1H |
| InChIKey | UMWMMWPYHRZQHG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen?
The IUPAC name of N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen (CID 156715445) is N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen.
What is the SMILES notation for N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen?
The canonical SMILES for N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen is C=C/N=C(\C)NC(=C)C.[H][H].
What is the InChIKey of N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen?
The InChIKey is UMWMMWPYHRZQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.H2/c1-5-8-7(4)9-6(2)3;/h5H,1-2H2,3-4H3,(H,8,9);1H.
What are the key properties of N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen?
N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen has a molecular weight of 126.20 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N-prop-1-en-2-ylethanimidamide;molecular hydrogen is sourced from PubChem (CID 156715445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).