C17H13FO5S — CID 144727172
2-(4-fluorophenyl)-5-hydroxy-6-(methylsulfonylmethyl)-1-benzofuran-3-carbaldehyde (PubChem CID 144727172) has the molecular formula C17H13FO5S and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-hydroxy-6-(methylsulfonylmethyl)-1-benzofuran-3-carbaldehyde.
| Compound Name | 2-(4-fluorophenyl)-5-hydroxy-6-(methylsulfonylmethyl)-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 144727172 |
| Molecular Formula | C17H13FO5S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-(4-fluorophenyl)-5-hydroxy-6-(methylsulfonylmethyl)-1-benzofuran-3-carbaldehyde |
| SMILES | CS(=O)(=O)Cc1cc2oc(-c3ccc(F)cc3)c(C=O)c2cc1O |
| InChI | InChI=1S/C17H13FO5S/c1-24(21,22)9-11-6-16-13(7-15(11)20)14(8-19)17(23-16)10-2-4-12(18)5-3-10/h2-8,20H,9H2,1H3 |
| InChIKey | ADHBKOKRPCZINA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|