C18H15FO4 — CID 130469029
2-(4-fluorophenyl)-6-hydroxy-5-propan-2-yloxy-1-benzofuran-3-carbaldehyde (PubChem CID 130469029) has the molecular formula C18H15FO4 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-hydroxy-5-propan-2-yloxy-1-benzofuran-3-carbaldehyde.
| Compound Name | 2-(4-fluorophenyl)-6-hydroxy-5-propan-2-yloxy-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 130469029 |
| Molecular Formula | C18H15FO4 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-(4-fluorophenyl)-6-hydroxy-5-propan-2-yloxy-1-benzofuran-3-carbaldehyde |
| SMILES | CC(C)Oc1cc2c(C=O)c(-c3ccc(F)cc3)oc2cc1O |
| InChI | InChI=1S/C18H15FO4/c1-10(2)22-17-7-13-14(9-20)18(23-16(13)8-15(17)21)11-3-5-12(19)6-4-11/h3-10,21H,1-2H3 |
| InChIKey | CJIPTPWWJAZMGW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|