C20H21N3O4S — CID 144727669
[4-(hydroxyamino)phenyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate (PubChem CID 144727669) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is [4-(hydroxyamino)phenyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate.
| Compound Name | [4-(hydroxyamino)phenyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate |
|---|---|
| PubChem CID | 144727669 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [4-(hydroxyamino)phenyl] (NZ)-N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamate |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)Oc2ccc(NO)cc2)c1 |
| InChI | InChI=1S/C20H21N3O4S/c1-12(2)16-9-4-13(3)10-17(16)23-18(24)11-28-19(23)21-20(25)27-15-7-5-14(22-26)6-8-15/h4-10,12,22,26H,11H2,1-3H3/b21-19- |
| InChIKey | ZBDDMDWLKRLPKE-VZCXRCSSSA-N |
| XLogP | 4.55 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|