C26H44N4O5 — CID 144731863
[5-[2,4-dimethyl-4-[4-(2-methylpropyl)triazol-1-yl]pentan-2-yl]oxy-2-nitrophenyl]methyl acetate;ethane (PubChem CID 144731863) has the molecular formula C26H44N4O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is [5-[2,4-dimethyl-4-[4-(2-methylpropyl)triazol-1-yl]pentan-2-yl]oxy-2-nitrophenyl]methyl acetate;ethane.
| Compound Name | [5-[2,4-dimethyl-4-[4-(2-methylpropyl)triazol-1-yl]pentan-2-yl]oxy-2-nitrophenyl]methyl acetate;ethane |
|---|---|
| PubChem CID | 144731863 |
| Molecular Formula | C26H44N4O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | [5-[2,4-dimethyl-4-[4-(2-methylpropyl)triazol-1-yl]pentan-2-yl]oxy-2-nitrophenyl]methyl acetate;ethane |
| SMILES | CC.CC.CC(=O)OCc1cc(OC(C)(C)CC(C)(C)n2cc(CC(C)C)nn2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H32N4O5.2C2H6/c1-15(2)10-18-12-25(24-23-18)21(4,5)14-22(6,7)31-19-8-9-20(26(28)29)17(11-19)13-30-16(3)27;2*1-2/h8-9,11-12,15H,10,13-14H2,1-7H3;2*1-2H3 |
| InChIKey | PQALICAOXFFAPY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|