C22H22N8O3 — CID 144733025
6-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-1-(2,3-dihydro-1-benzofuran-5-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 144733025) has the molecular formula C22H22N8O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is 6-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-1-(2,3-dihydro-1-benzofuran-5-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | 6-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-1-(2,3-dihydro-1-benzofuran-5-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144733025 |
| Molecular Formula | C22H22N8O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 6-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-1-(2,3-dihydro-1-benzofuran-5-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | N/N=C(\NN)c1ccc(N2CCc3c(C(N)=O)nn(-c4ccc5c(c4)CCO5)c3C2=O)cc1 |
| InChI | InChI=1S/C22H22N8O3/c23-20(31)18-16-7-9-29(14-3-1-12(2-4-14)21(26-24)27-25)22(32)19(16)30(28-18)15-5-6-17-13(11-15)8-10-33-17/h1-6,11H,7-10,24-25H2,(H2,23,31)(H,26,27) |
| InChIKey | OKIWUTWQUNMVDU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 166.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|