C12H15N3O — CID 62199049
N-amino-N'-cyclopropyl-2,3-dihydro-1-benzofuran-5-carboximidamide (PubChem CID 62199049) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-amino-N'-cyclopropyl-2,3-dihydro-1-benzofuran-5-carboximidamide.
| Compound Name | N-amino-N'-cyclopropyl-2,3-dihydro-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 62199049 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-amino-N'-cyclopropyl-2,3-dihydro-1-benzofuran-5-carboximidamide |
| SMILES | NN/C(=N\C1CC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H15N3O/c13-15-12(14-10-2-3-10)9-1-4-11-8(7-9)5-6-16-11/h1,4,7,10H,2-3,5-6,13H2,(H,14,15) |
| InChIKey | UWXJAINQCXNUNA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|