C24H29NO4S — CID 144734161
1-[3-(benzylsulfanylmethyl)-2,5-dioxopyrrolidin-1-yl]propan-2-yl benzoate;ethane (PubChem CID 144734161) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[3-(benzylsulfanylmethyl)-2,5-dioxopyrrolidin-1-yl]propan-2-yl benzoate;ethane.
| Compound Name | 1-[3-(benzylsulfanylmethyl)-2,5-dioxopyrrolidin-1-yl]propan-2-yl benzoate;ethane |
|---|---|
| PubChem CID | 144734161 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[3-(benzylsulfanylmethyl)-2,5-dioxopyrrolidin-1-yl]propan-2-yl benzoate;ethane |
| SMILES | CC.CC(CN1C(=O)CC(CSCc2ccccc2)C1=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4S.C2H6/c1-16(27-22(26)18-10-6-3-7-11-18)13-23-20(24)12-19(21(23)25)15-28-14-17-8-4-2-5-9-17;1-2/h2-11,16,19H,12-15H2,1H3;1-2H3 |
| InChIKey | MSIROXWAPWRZBD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|