C19H26N2O3 — CID 144735643
(1S,4R,7E)-4,8-dimethyl-12-[(2-methylimidazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 144735643) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (1S,4R,7E)-4,8-dimethyl-12-[(2-methylimidazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,4R,7E)-4,8-dimethyl-12-[(2-methylimidazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 144735643 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1S,4R,7E)-4,8-dimethyl-12-[(2-methylimidazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C/C1=C\CC[C@@]2(C)OC2[C@H]2OC(=O)C(Cn3ccnc3C)C2CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-12-5-4-8-19(3)17(24-19)16-14(7-6-12)15(18(22)23-16)11-21-10-9-20-13(21)2/h5,9-10,14-17H,4,6-8,11H2,1-3H3/b12-5+/t14?,15?,16-,17?,19+/m0/s1 |
| InChIKey | CTWNCTXYIPPNSV-NGOIAJIMSA-N |
| XLogP | 3.03 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|