C8H18N2 — CID 144735707
ethane;(5S)-5-ethyl-2-methyl-4,5-dihydro-1H-imidazole (PubChem CID 144735707) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is ethane;(5S)-5-ethyl-2-methyl-4,5-dihydro-1H-imidazole.
| Compound Name | ethane;(5S)-5-ethyl-2-methyl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 144735707 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | ethane;(5S)-5-ethyl-2-methyl-4,5-dihydro-1H-imidazole |
| SMILES | CC.CC[C@H]1CN=C(C)N1 |
| InChI | InChI=1S/C6H12N2.C2H6/c1-3-6-4-7-5(2)8-6;1-2/h6H,3-4H2,1-2H3,(H,7,8);1-2H3/t6-;/m0./s1 |
| InChIKey | ZPMKIXINMFMGDI-RGMNGODLSA-N |
| XLogP | 1.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |