About 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine
5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine (PubChem CID 58801114) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine.
Analyze 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine?
The IUPAC name of 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine (CID 58801114) is 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine.
What is the SMILES notation for 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine?
The canonical SMILES for 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine is CC1=NCC(F)CCN1.
What is the InChIKey of 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine?
The InChIKey is JJAQILVALVDFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2/c1-5-8-3-2-6(7)4-9-5/h6H,2-4H2,1H3,(H,8,9).
What are the key properties of 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine?
5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine has a molecular weight of 130.17 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-4,5,6,7-tetrahydro-1H-1,3-diazepine is sourced from PubChem (CID 58801114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).