C27H34P+ — CID 144736397
triphenyl(2,4,4-trimethylhexan-2-yl)phosphanium (PubChem CID 144736397) has the molecular formula C27H34P+ and a molecular weight of 389.54 g/mol. Its IUPAC name is triphenyl(2,4,4-trimethylhexan-2-yl)phosphanium.
| Compound Name | triphenyl(2,4,4-trimethylhexan-2-yl)phosphanium |
|---|---|
| PubChem CID | 144736397 |
| Molecular Formula | C27H34P+ |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | triphenyl(2,4,4-trimethylhexan-2-yl)phosphanium |
| SMILES | CCC(C)(C)CC(C)(C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34P/c1-6-26(2,3)22-27(4,5)28(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21H,6,22H2,1-5H3/q+1 |
| InChIKey | GMYBPVSBNNJTNS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|