C22H22ClNO2 — CID 144739122
2-[[5-(3-chlorophenyl)-2-methylphenoxy]methyl]-3-methoxy-N-methylaniline (PubChem CID 144739122) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-2-methylphenoxy]methyl]-3-methoxy-N-methylaniline.
| Compound Name | 2-[[5-(3-chlorophenyl)-2-methylphenoxy]methyl]-3-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 144739122 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-2-methylphenoxy]methyl]-3-methoxy-N-methylaniline |
| SMILES | CNc1cccc(OC)c1COc1cc(-c2cccc(Cl)c2)ccc1C |
| InChI | InChI=1S/C22H22ClNO2/c1-15-10-11-17(16-6-4-7-18(23)12-16)13-22(15)26-14-19-20(24-2)8-5-9-21(19)25-3/h4-13,24H,14H2,1-3H3 |
| InChIKey | LPLBJNMTXIDUAB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |