C24H24N2O — CID 144784809
3-[4-[[2-ethyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]benzonitrile (PubChem CID 144784809) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[4-[[2-ethyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]benzonitrile.
| Compound Name | 3-[4-[[2-ethyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]benzonitrile |
|---|---|
| PubChem CID | 144784809 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-[4-[[2-ethyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]benzonitrile |
| SMILES | CCc1cccc(NC)c1COc1ccc(-c2cccc(C#N)c2)cc1C |
| InChI | InChI=1S/C24H24N2O/c1-4-19-8-6-10-23(26-3)22(19)16-27-24-12-11-21(13-17(24)2)20-9-5-7-18(14-20)15-25/h5-14,26H,4,16H2,1-3H3 |
| InChIKey | FJPJUFUEAQVCAC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |