C24H29N5O3 — CID 144597796
N-amino-N-methylformamide;3-methoxy-N-methyl-2-[[2-methyl-4-(1-prop-2-ynylpyrazol-3-yl)phenoxy]methyl]aniline (PubChem CID 144597796) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-amino-N-methylformamide;3-methoxy-N-methyl-2-[[2-methyl-4-(1-prop-2-ynylpyrazol-3-yl)phenoxy]methyl]aniline.
| Compound Name | N-amino-N-methylformamide;3-methoxy-N-methyl-2-[[2-methyl-4-(1-prop-2-ynylpyrazol-3-yl)phenoxy]methyl]aniline |
|---|---|
| PubChem CID | 144597796 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-amino-N-methylformamide;3-methoxy-N-methyl-2-[[2-methyl-4-(1-prop-2-ynylpyrazol-3-yl)phenoxy]methyl]aniline |
| SMILES | C#CCn1ccc(-c2ccc(OCc3c(NC)cccc3OC)c(C)c2)n1.CN(N)C=O |
| InChI | InChI=1S/C22H23N3O2.C2H6N2O/c1-5-12-25-13-11-19(24-25)17-9-10-21(16(2)14-17)27-15-18-20(23-3)7-6-8-22(18)26-4;1-4(3)2-5/h1,6-11,13-14,23H,12,15H2,2-4H3;2H,3H2,1H3 |
| InChIKey | GCTCTRFKPHQKEU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|