C23H22N4O4 — CID 144739652
N-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-4-(6-nitro-1H-benzimidazol-2-yl)butanamide (PubChem CID 144739652) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-4-(6-nitro-1H-benzimidazol-2-yl)butanamide.
| Compound Name | N-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-4-(6-nitro-1H-benzimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 144739652 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-4-(6-nitro-1H-benzimidazol-2-yl)butanamide |
| SMILES | O=C(CCCc1nc2ccc([N+](=O)[O-])cc2[nH]1)Nc1ccc(OC2=CCCC=C2)cc1 |
| InChI | InChI=1S/C23H22N4O4/c28-23(24-16-9-12-19(13-10-16)31-18-5-2-1-3-6-18)8-4-7-22-25-20-14-11-17(27(29)30)15-21(20)26-22/h2,5-6,9-15H,1,3-4,7-8H2,(H,24,28)(H,25,26) |
| InChIKey | WWOKPBBHHPWSDC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|