C26H46N2O10 — CID 144742411
[5-acetamido-2-(1-acetyloxypropyl)-3-hydroxy-6-[6-(6-hydroxyhexylamino)-6-oxohexoxy]oxan-4-yl] acetate (PubChem CID 144742411) has the molecular formula C26H46N2O10 and a molecular weight of 546.66 g/mol. Its IUPAC name is [5-acetamido-2-(1-acetyloxypropyl)-3-hydroxy-6-[6-(6-hydroxyhexylamino)-6-oxohexoxy]oxan-4-yl] acetate.
| Compound Name | [5-acetamido-2-(1-acetyloxypropyl)-3-hydroxy-6-[6-(6-hydroxyhexylamino)-6-oxohexoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 144742411 |
| Molecular Formula | C26H46N2O10 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | [5-acetamido-2-(1-acetyloxypropyl)-3-hydroxy-6-[6-(6-hydroxyhexylamino)-6-oxohexoxy]oxan-4-yl] acetate |
| SMILES | CCC(OC(C)=O)C1OC(OCCCCCC(=O)NCCCCCCO)C(NC(C)=O)C(OC(C)=O)C1O |
| InChI | InChI=1S/C26H46N2O10/c1-5-20(36-18(3)31)24-23(34)25(37-19(4)32)22(28-17(2)30)26(38-24)35-16-12-8-9-13-21(33)27-14-10-6-7-11-15-29/h20,22-26,29,34H,5-16H2,1-4H3,(H,27,33)(H,28,30) |
| InChIKey | WTOASYLAKDRCCJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|