C50H89N7O20 — CID 170382950
N-[1,3-bis[3-[3-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]propylamino]-3-oxopropoxy]propan-2-yl]-8-oxononanamide (PubChem CID 170382950) has the molecular formula C50H89N7O20 and a molecular weight of 1108.29 g/mol. Its IUPAC name is N-[1,3-bis[3-[3-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]propylamino]-3-oxopropoxy]propan-2-yl]-8-oxononanamide.
| Compound Name | N-[1,3-bis[3-[3-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]propylamino]-3-oxopropoxy]propan-2-yl]-8-oxononanamide |
|---|---|
| PubChem CID | 170382950 |
| Molecular Formula | C50H89N7O20 |
| Molecular Weight | 1108.29 g/mol |
| Exact Mass | 1107.62 |
| IUPAC Name | N-[1,3-bis[3-[3-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]propylamino]-3-oxopropoxy]propan-2-yl]-8-oxononanamide |
| SMILES | CC(=O)CCCCCCC(=O)NC(COCCC(=O)NCCCNC(=O)CCCCOC1OC(CO)C(O)C(O)C1NC(C)=O)COCCC(=O)NCCCNC(=O)CCCCOC1OC(CO)C(O)C(O)C1NC(C)=O |
| InChI | InChI=1S/C50H89N7O20/c1-32(60)14-6-4-5-7-17-42(67)57-35(30-72-26-18-40(65)53-22-12-20-51-38(63)15-8-10-24-74-49-43(55-33(2)61)47(70)45(68)36(28-58)76-49)31-73-27-19-41(66)54-23-13-21-52-39(64)16-9-11-25-75-50-44(56-34(3)62)48(71)46(69)37(29-59)77-50/h35-37,43-50,58-59,68-71H,4-31H2,1-3H3,(H,51,63)(H,52,64)(H,53,65)(H,54,66)(H,55,61)(H,56,62)(H,57,67) |
| InChIKey | VJBJBWFSIJRMMG-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 397.53 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.29 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|