About dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane
dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane (PubChem CID 144742537) has the molecular formula C15H34NO4PS
and a molecular weight of 355.48 g/mol. Its IUPAC name is dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane.
Molecular Properties
| Compound Name | dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane |
| PubChem CID | 144742537 |
| Molecular Formula | C15H34NO4PS |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane |
| SMILES | CC.CC.COP(OC)O[C@@H]1CCN(C(=O)CCCSC)C1 |
| InChI | InChI=1S/C11H22NO4PS.2C2H6/c1-14-17(15-2)16-10-6-7-12(9-10)11(13)5-4-8-18-3;2*1-2/h10H,4-9H2,1-3H3;2*1-2H3/t10-;;/m1../s1 |
| InChIKey | DVJNXCPNXOTLJE-YQFADDPSSA-N |
| XLogP | 4.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane?
The IUPAC name of dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane (CID 144742537) is dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane.
What is the SMILES notation for dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane?
The canonical SMILES for dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane is CC.CC.COP(OC)O[C@@H]1CCN(C(=O)CCCSC)C1.
What is the InChIKey of dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane?
The InChIKey is DVJNXCPNXOTLJE-YQFADDPSSA-N. The full InChI is InChI=1S/C11H22NO4PS.2C2H6/c1-14-17(15-2)16-10-6-7-12(9-10)11(13)5-4-8-18-3;2*1-2/h10H,4-9H2,1-3H3;2*1-2H3/t10-;;/m1../s1.
What are the key properties of dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane?
dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane has a molecular weight of 355.48 g/mol, XLogP of 4.32, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl [(3R)-1-(4-methylsulfanylbutanoyl)pyrrolidin-3-yl] phosphite;ethane is sourced from PubChem (CID 144742537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).