C22H25NO2 — CID 144743765
N-(4-methyl-2,3-dihydro-1H-inden-1-yl)-N-[(2R)-3-methyl-1-oxobut-3-en-2-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144743765) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(4-methyl-2,3-dihydro-1H-inden-1-yl)-N-[(2R)-3-methyl-1-oxobut-3-en-2-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-(4-methyl-2,3-dihydro-1H-inden-1-yl)-N-[(2R)-3-methyl-1-oxobut-3-en-2-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 144743765 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-(4-methyl-2,3-dihydro-1H-inden-1-yl)-N-[(2R)-3-methyl-1-oxobut-3-en-2-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=C(C)[C@H](C=O)N(C(=O)C1=CCCC=C1)C1CCc2c(C)cccc21 |
| InChI | InChI=1S/C22H25NO2/c1-15(2)21(14-24)23(22(25)17-9-5-4-6-10-17)20-13-12-18-16(3)8-7-11-19(18)20/h5,7-11,14,20-21H,1,4,6,12-13H2,2-3H3/t20?,21-/m0/s1 |
| InChIKey | WFUXWCBGEUKCGD-LBAQZLPGSA-N |
| XLogP | 4.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|