C14H29N3O2 — CID 144745493
methyl N-[2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]ethyl]carbamate;molecular hydrogen (PubChem CID 144745493) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is methyl N-[2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]ethyl]carbamate;molecular hydrogen.
| Compound Name | methyl N-[2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]ethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 144745493 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | methyl N-[2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]ethyl]carbamate;molecular hydrogen |
| SMILES | COC(=O)NCCN[C@H]1CCCC[C@@H]1N1CCCC1.[H][H] |
| InChI | InChI=1S/C14H27N3O2.H2/c1-19-14(18)16-9-8-15-12-6-2-3-7-13(12)17-10-4-5-11-17;/h12-13,15H,2-11H2,1H3,(H,16,18);1H/t12-,13-;/m0./s1 |
| InChIKey | UPQQQWYOVWNWPM-QNTKWALQSA-N |
| XLogP | 1.59 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|