C14H31N3O2 — CID 144745497
1-cyclohexylpyrrolidine;methyl N-(2-aminoethyl)carbamate;molecular hydrogen (PubChem CID 144745497) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-cyclohexylpyrrolidine;methyl N-(2-aminoethyl)carbamate;molecular hydrogen.
| Compound Name | 1-cyclohexylpyrrolidine;methyl N-(2-aminoethyl)carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 144745497 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | 1-cyclohexylpyrrolidine;methyl N-(2-aminoethyl)carbamate;molecular hydrogen |
| SMILES | C1CCC(N2CCCC2)CC1.COC(=O)NCCN.[H][H] |
| InChI | InChI=1S/C10H19N.C4H10N2O2.H2/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-8-4(7)6-3-2-5;/h10H,1-9H2;2-3,5H2,1H3,(H,6,7);1H |
| InChIKey | JBEILSBTXTUQRW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |